About ethane;N-(2-methoxyethyl)-N,2-dimethyl-4-(trifluoromethyl)aniline
ethane;N-(2-methoxyethyl)-N,2-dimethyl-4-(trifluoromethyl)aniline (PubChem CID 143095395) has the molecular formula C14H22F3NO
and a molecular weight of 277.33 g/mol. Its IUPAC name is ethane;N-(2-methoxyethyl)-N,2-dimethyl-4-(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | ethane;N-(2-methoxyethyl)-N,2-dimethyl-4-(trifluoromethyl)aniline |
| PubChem CID | 143095395 |
| Molecular Formula | C14H22F3NO |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | ethane;N-(2-methoxyethyl)-N,2-dimethyl-4-(trifluoromethyl)aniline |
| SMILES | CC.COCCN(C)c1ccc(C(F)(F)F)cc1C |
| InChI | InChI=1S/C12H16F3NO.C2H6/c1-9-8-10(12(13,14)15)4-5-11(9)16(2)6-7-17-3;1-2/h4-5,8H,6-7H2,1-3H3;1-2H3 |
| InChIKey | XLAABFGKNXESQD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;N-(2-methoxyethyl)-N,2-dimethyl-4-(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(2-methoxyethyl)-N,2-dimethyl-4-(trifluoromethyl)aniline?
The IUPAC name of ethane;N-(2-methoxyethyl)-N,2-dimethyl-4-(trifluoromethyl)aniline (CID 143095395) is ethane;N-(2-methoxyethyl)-N,2-dimethyl-4-(trifluoromethyl)aniline.
What is the SMILES notation for ethane;N-(2-methoxyethyl)-N,2-dimethyl-4-(trifluoromethyl)aniline?
The canonical SMILES for ethane;N-(2-methoxyethyl)-N,2-dimethyl-4-(trifluoromethyl)aniline is CC.COCCN(C)c1ccc(C(F)(F)F)cc1C.
What is the InChIKey of ethane;N-(2-methoxyethyl)-N,2-dimethyl-4-(trifluoromethyl)aniline?
The InChIKey is XLAABFGKNXESQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F3NO.C2H6/c1-9-8-10(12(13,14)15)4-5-11(9)16(2)6-7-17-3;1-2/h4-5,8H,6-7H2,1-3H3;1-2H3.
What are the key properties of ethane;N-(2-methoxyethyl)-N,2-dimethyl-4-(trifluoromethyl)aniline?
ethane;N-(2-methoxyethyl)-N,2-dimethyl-4-(trifluoromethyl)aniline has a molecular weight of 277.33 g/mol, XLogP of 4.12, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(2-methoxyethyl)-N,2-dimethyl-4-(trifluoromethyl)aniline is sourced from PubChem (CID 143095395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).