C21H25F3N2O2 — CID 71278074
N-[2-[2-ethoxyethyl(methyl)amino]-5-(trifluoromethyl)phenyl]-3,4-dimethylbenzamide (PubChem CID 71278074) has the molecular formula C21H25F3N2O2 and a molecular weight of 394.44 g/mol. Its IUPAC name is N-[2-[2-ethoxyethyl(methyl)amino]-5-(trifluoromethyl)phenyl]-3,4-dimethylbenzamide.
| Compound Name | N-[2-[2-ethoxyethyl(methyl)amino]-5-(trifluoromethyl)phenyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 71278074 |
| Molecular Formula | C21H25F3N2O2 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | N-[2-[2-ethoxyethyl(methyl)amino]-5-(trifluoromethyl)phenyl]-3,4-dimethylbenzamide |
| SMILES | CCOCCN(C)c1ccc(C(F)(F)F)cc1NC(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C21H25F3N2O2/c1-5-28-11-10-26(4)19-9-8-17(21(22,23)24)13-18(19)25-20(27)16-7-6-14(2)15(3)12-16/h6-9,12-13H,5,10-11H2,1-4H3,(H,25,27) |
| InChIKey | MSPJLICNJZMJAH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|