C12H12BrClN4O2 — CID 62858053
N-(5-bromo-2-methoxyphenyl)-4-chloro-6-ethoxy-1,3,5-triazin-2-amine (PubChem CID 62858053) has the molecular formula C12H12BrClN4O2 and a molecular weight of 359.61 g/mol. Its IUPAC name is N-(5-bromo-2-methoxyphenyl)-4-chloro-6-ethoxy-1,3,5-triazin-2-amine.
| Compound Name | N-(5-bromo-2-methoxyphenyl)-4-chloro-6-ethoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 62858053 |
| Molecular Formula | C12H12BrClN4O2 |
| Molecular Weight | 359.61 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | N-(5-bromo-2-methoxyphenyl)-4-chloro-6-ethoxy-1,3,5-triazin-2-amine |
| SMILES | CCOc1nc(Cl)nc(Nc2cc(Br)ccc2OC)n1 |
| InChI | InChI=1S/C12H12BrClN4O2/c1-3-20-12-17-10(14)16-11(18-12)15-8-6-7(13)4-5-9(8)19-2/h4-6H,3H2,1-2H3,(H,15,16,17,18) |
| InChIKey | CWGGZAOGAAZJIC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.61 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |