C10H13ClN4O2 — CID 62858844
1-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)piperidine-2-carbaldehyde (PubChem CID 62858844) has the molecular formula C10H13ClN4O2 and a molecular weight of 256.69 g/mol. Its IUPAC name is 1-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)piperidine-2-carbaldehyde.
| Compound Name | 1-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)piperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 62858844 |
| Molecular Formula | C10H13ClN4O2 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 1-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)piperidine-2-carbaldehyde |
| SMILES | COc1nc(Cl)nc(N2CCCCC2C=O)n1 |
| InChI | InChI=1S/C10H13ClN4O2/c1-17-10-13-8(11)12-9(14-10)15-5-3-2-4-7(15)6-16/h6-7H,2-5H2,1H3 |
| InChIKey | BPJIWTKDEYWXHZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|