C13H16N4OS — CID 6285963
1,1,3-trimethyl-3-[(E)-(1-methyl-2-oxoindol-3-ylidene)amino]thiourea (PubChem CID 6285963) has the molecular formula C13H16N4OS and a molecular weight of 276.37 g/mol. Its IUPAC name is 1,1,3-trimethyl-3-[(E)-(1-methyl-2-oxoindol-3-ylidene)amino]thiourea.
| Compound Name | 1,1,3-trimethyl-3-[(E)-(1-methyl-2-oxoindol-3-ylidene)amino]thiourea |
|---|---|
| PubChem CID | 6285963 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 1,1,3-trimethyl-3-[(E)-(1-methyl-2-oxoindol-3-ylidene)amino]thiourea |
| SMILES | CN(C)C(=S)N(C)/N=C1/C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C13H16N4OS/c1-15(2)13(19)17(4)14-11-9-7-5-6-8-10(9)16(3)12(11)18/h5-8H,1-4H3/b14-11+ |
| InChIKey | VSDRBAGIKBACNR-SDNWHVSQSA-N |
| XLogP | 1.15 |
| TPSA | 39.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|