About 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]-N-methylaniline
4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]-N-methylaniline (PubChem CID 62859687) has the molecular formula C11H11ClN4O2
and a molecular weight of 266.69 g/mol. Its IUPAC name is 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]-N-methylaniline.
Molecular Properties
| Compound Name | 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]-N-methylaniline |
| PubChem CID | 62859687 |
| Molecular Formula | C11H11ClN4O2 |
| Molecular Weight | 266.69 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]-N-methylaniline |
| SMILES | CNc1ccc(Oc2nc(Cl)nc(OC)n2)cc1 |
| InChI | InChI=1S/C11H11ClN4O2/c1-13-7-3-5-8(6-4-7)18-11-15-9(12)14-10(16-11)17-2/h3-6,13H,1-2H3 |
| InChIKey | YPXQVRCTMXPQKA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.69 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]-N-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]-N-methylaniline?
The IUPAC name of 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]-N-methylaniline (CID 62859687) is 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]-N-methylaniline.
What is the SMILES notation for 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]-N-methylaniline?
The canonical SMILES for 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]-N-methylaniline is CNc1ccc(Oc2nc(Cl)nc(OC)n2)cc1.
What is the InChIKey of 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]-N-methylaniline?
The InChIKey is YPXQVRCTMXPQKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClN4O2/c1-13-7-3-5-8(6-4-7)18-11-15-9(12)14-10(16-11)17-2/h3-6,13H,1-2H3.
What are the key properties of 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]-N-methylaniline?
4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]-N-methylaniline has a molecular weight of 266.69 g/mol, XLogP of 2.37, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]-N-methylaniline is sourced from PubChem (CID 62859687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).