C10H19NO4S — CID 62862361
4-[cyclobutylmethyl(methyl)sulfamoyl]butanoic acid (PubChem CID 62862361) has the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. Its IUPAC name is 4-[cyclobutylmethyl(methyl)sulfamoyl]butanoic acid.
| Compound Name | 4-[cyclobutylmethyl(methyl)sulfamoyl]butanoic acid |
|---|---|
| PubChem CID | 62862361 |
| Molecular Formula | C10H19NO4S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 4-[cyclobutylmethyl(methyl)sulfamoyl]butanoic acid |
| SMILES | CN(CC1CCC1)S(=O)(=O)CCCC(=O)O |
| InChI | InChI=1S/C10H19NO4S/c1-11(8-9-4-2-5-9)16(14,15)7-3-6-10(12)13/h9H,2-8H2,1H3,(H,12,13) |
| InChIKey | FRLQZIIAPKULHQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |