C12H14ClN5O — CID 62870587
4-chloro-6-propoxy-N-(pyridin-4-ylmethyl)-1,3,5-triazin-2-amine (PubChem CID 62870587) has the molecular formula C12H14ClN5O and a molecular weight of 279.73 g/mol. Its IUPAC name is 4-chloro-6-propoxy-N-(pyridin-4-ylmethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-propoxy-N-(pyridin-4-ylmethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 62870587 |
| Molecular Formula | C12H14ClN5O |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 4-chloro-6-propoxy-N-(pyridin-4-ylmethyl)-1,3,5-triazin-2-amine |
| SMILES | CCCOc1nc(Cl)nc(NCc2ccncc2)n1 |
| InChI | InChI=1S/C12H14ClN5O/c1-2-7-19-12-17-10(13)16-11(18-12)15-8-9-3-5-14-6-4-9/h3-6H,2,7-8H2,1H3,(H,15,16,17,18) |
| InChIKey | WYDAOZZJYPQJAL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |