C12H18N2O2 — CID 62871703
N-ethyl-2-(4-methoxy-2-methylanilino)acetamide (PubChem CID 62871703) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is N-ethyl-2-(4-methoxy-2-methylanilino)acetamide.
| Compound Name | N-ethyl-2-(4-methoxy-2-methylanilino)acetamide |
|---|---|
| PubChem CID | 62871703 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | N-ethyl-2-(4-methoxy-2-methylanilino)acetamide |
| SMILES | CCNC(=O)CNc1ccc(OC)cc1C |
| InChI | InChI=1S/C12H18N2O2/c1-4-13-12(15)8-14-11-6-5-10(16-3)7-9(11)2/h5-7,14H,4,8H2,1-3H3,(H,13,15) |
| InChIKey | PSGMWCYYPHYLKT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|