C12H22N2O2S — CID 62872953
methyl 3-(1,4-diazepan-1-yl)thiane-3-carboxylate (PubChem CID 62872953) has the molecular formula C12H22N2O2S and a molecular weight of 258.39 g/mol. Its IUPAC name is methyl 3-(1,4-diazepan-1-yl)thiane-3-carboxylate.
| Compound Name | methyl 3-(1,4-diazepan-1-yl)thiane-3-carboxylate |
|---|---|
| PubChem CID | 62872953 |
| Molecular Formula | C12H22N2O2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | methyl 3-(1,4-diazepan-1-yl)thiane-3-carboxylate |
| SMILES | COC(=O)C1(N2CCCNCC2)CCCSC1 |
| InChI | InChI=1S/C12H22N2O2S/c1-16-11(15)12(4-2-9-17-10-12)14-7-3-5-13-6-8-14/h13H,2-10H2,1H3 |
| InChIKey | YSOXRYOFUFZRKK-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |