C13H11Br2N3O2 — CID 62874469
N-(2-amino-4,6-dibromophenyl)-2-methoxypyridine-3-carboxamide (PubChem CID 62874469) has the molecular formula C13H11Br2N3O2 and a molecular weight of 401.06 g/mol. Its IUPAC name is N-(2-amino-4,6-dibromophenyl)-2-methoxypyridine-3-carboxamide.
| Compound Name | N-(2-amino-4,6-dibromophenyl)-2-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 62874469 |
| Molecular Formula | C13H11Br2N3O2 |
| Molecular Weight | 401.06 g/mol |
| Exact Mass | 398.92 |
| IUPAC Name | N-(2-amino-4,6-dibromophenyl)-2-methoxypyridine-3-carboxamide |
| SMILES | COc1ncccc1C(=O)Nc1c(N)cc(Br)cc1Br |
| InChI | InChI=1S/C13H11Br2N3O2/c1-20-13-8(3-2-4-17-13)12(19)18-11-9(15)5-7(14)6-10(11)16/h2-6H,16H2,1H3,(H,18,19) |
| InChIKey | FAWNATVKOZNMDU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.06 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|