C19H20O — CID 62880387
2-(3,4-dimethylphenyl)-1-(1-phenylcyclopropyl)ethanone (PubChem CID 62880387) has the molecular formula C19H20O and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-1-(1-phenylcyclopropyl)ethanone.
| Compound Name | 2-(3,4-dimethylphenyl)-1-(1-phenylcyclopropyl)ethanone |
|---|---|
| PubChem CID | 62880387 |
| Molecular Formula | C19H20O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-1-(1-phenylcyclopropyl)ethanone |
| SMILES | Cc1ccc(CC(=O)C2(c3ccccc3)CC2)cc1C |
| InChI | InChI=1S/C19H20O/c1-14-8-9-16(12-15(14)2)13-18(20)19(10-11-19)17-6-4-3-5-7-17/h3-9,12H,10-11,13H2,1-2H3 |
| InChIKey | AFOASYJNTYSGRS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |