C20H22O — CID 63410082
2-(3-methylphenyl)-1-(1-phenylcyclopentyl)ethanone (PubChem CID 63410082) has the molecular formula C20H22O and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-(3-methylphenyl)-1-(1-phenylcyclopentyl)ethanone.
| Compound Name | 2-(3-methylphenyl)-1-(1-phenylcyclopentyl)ethanone |
|---|---|
| PubChem CID | 63410082 |
| Molecular Formula | C20H22O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2-(3-methylphenyl)-1-(1-phenylcyclopentyl)ethanone |
| SMILES | Cc1cccc(CC(=O)C2(c3ccccc3)CCCC2)c1 |
| InChI | InChI=1S/C20H22O/c1-16-8-7-9-17(14-16)15-19(21)20(12-5-6-13-20)18-10-3-2-4-11-18/h2-4,7-11,14H,5-6,12-13,15H2,1H3 |
| InChIKey | CXMXEDRWOOWKHP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |