C10H8F3N3OS — CID 62881173
5-sulfanylidene-4-[[2-(trifluoromethyl)phenyl]methyl]-1,2,4-triazolidin-3-one (PubChem CID 62881173) has the molecular formula C10H8F3N3OS and a molecular weight of 275.25 g/mol. Its IUPAC name is 5-sulfanylidene-4-[[2-(trifluoromethyl)phenyl]methyl]-1,2,4-triazolidin-3-one.
| Compound Name | 5-sulfanylidene-4-[[2-(trifluoromethyl)phenyl]methyl]-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 62881173 |
| Molecular Formula | C10H8F3N3OS |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 5-sulfanylidene-4-[[2-(trifluoromethyl)phenyl]methyl]-1,2,4-triazolidin-3-one |
| SMILES | O=c1[nH][nH]c(=S)n1Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C10H8F3N3OS/c11-10(12,13)7-4-2-1-3-6(7)5-16-8(17)14-15-9(16)18/h1-4H,5H2,(H,14,17)(H,15,18) |
| InChIKey | ZQYSLEYTROVARC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 53.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|