C14H16F3N3 — CID 62881310
1-(1-methylpyrazol-4-yl)-N-[[4-(trifluoromethyl)phenyl]methyl]ethanamine (PubChem CID 62881310) has the molecular formula C14H16F3N3 and a molecular weight of 283.30 g/mol. Its IUPAC name is 1-(1-methylpyrazol-4-yl)-N-[[4-(trifluoromethyl)phenyl]methyl]ethanamine.
| Compound Name | 1-(1-methylpyrazol-4-yl)-N-[[4-(trifluoromethyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 62881310 |
| Molecular Formula | C14H16F3N3 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 1-(1-methylpyrazol-4-yl)-N-[[4-(trifluoromethyl)phenyl]methyl]ethanamine |
| SMILES | CC(NCc1ccc(C(F)(F)F)cc1)c1cnn(C)c1 |
| InChI | InChI=1S/C14H16F3N3/c1-10(12-8-19-20(2)9-12)18-7-11-3-5-13(6-4-11)14(15,16)17/h3-6,8-10,18H,7H2,1-2H3 |
| InChIKey | HGMLJVPRWGEJFG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |