C12H13ClN4O3S — CID 62882827
3-[(2-chloro-5-nitrophenyl)methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one (PubChem CID 62882827) has the molecular formula C12H13ClN4O3S and a molecular weight of 328.78 g/mol. Its IUPAC name is 3-[(2-chloro-5-nitrophenyl)methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[(2-chloro-5-nitrophenyl)methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 62882827 |
| Molecular Formula | C12H13ClN4O3S |
| Molecular Weight | 328.78 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 3-[(2-chloro-5-nitrophenyl)methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one |
| SMILES | CCCn1c(SCc2cc([N+](=O)[O-])ccc2Cl)n[nH]c1=O |
| InChI | InChI=1S/C12H13ClN4O3S/c1-2-5-16-11(18)14-15-12(16)21-7-8-6-9(17(19)20)3-4-10(8)13/h3-4,6H,2,5,7H2,1H3,(H,14,18) |
| InChIKey | GKOXHLDHEYCPFC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.78 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|