C12H16N4O2S — CID 62884595
3-[2-(2-aminophenyl)-2-hydroxyethyl]sulfanyl-4-ethyl-1H-1,2,4-triazol-5-one (PubChem CID 62884595) has the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is 3-[2-(2-aminophenyl)-2-hydroxyethyl]sulfanyl-4-ethyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[2-(2-aminophenyl)-2-hydroxyethyl]sulfanyl-4-ethyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 62884595 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 3-[2-(2-aminophenyl)-2-hydroxyethyl]sulfanyl-4-ethyl-1H-1,2,4-triazol-5-one |
| SMILES | CCn1c(SCC(O)c2ccccc2N)n[nH]c1=O |
| InChI | InChI=1S/C12H16N4O2S/c1-2-16-11(18)14-15-12(16)19-7-10(17)8-5-3-4-6-9(8)13/h3-6,10,17H,2,7,13H2,1H3,(H,14,18) |
| InChIKey | GGPKKONTWIIUAE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 96.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|