C9H17N5OS — CID 62884633
3-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]butanimidamide (PubChem CID 62884633) has the molecular formula C9H17N5OS and a molecular weight of 243.34 g/mol. Its IUPAC name is 3-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]butanimidamide.
| Compound Name | 3-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]butanimidamide |
|---|---|
| PubChem CID | 62884633 |
| Molecular Formula | C9H17N5OS |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 3-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]butanimidamide |
| SMILES | [H]/N=C(\N)CC(C)Sc1n[nH]c(=O)n1CCC |
| InChI | InChI=1S/C9H17N5OS/c1-3-4-14-8(15)12-13-9(14)16-6(2)5-7(10)11/h6H,3-5H2,1-2H3,(H3,10,11)(H,12,15) |
| InChIKey | LYIJIPOYGDSHMA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|