C11H18ClN3O — CID 62887028
[5-chloro-6-(pentoxymethyl)-2-pyridinyl]hydrazine (PubChem CID 62887028) has the molecular formula C11H18ClN3O and a molecular weight of 243.74 g/mol. Its IUPAC name is [5-chloro-6-(pentoxymethyl)-2-pyridinyl]hydrazine.
| Compound Name | [5-chloro-6-(pentoxymethyl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 62887028 |
| Molecular Formula | C11H18ClN3O |
| Molecular Weight | 243.74 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | [5-chloro-6-(pentoxymethyl)-2-pyridinyl]hydrazine |
| SMILES | CCCCCOCc1nc(NN)ccc1Cl |
| InChI | InChI=1S/C11H18ClN3O/c1-2-3-4-7-16-8-10-9(12)5-6-11(14-10)15-13/h5-6H,2-4,7-8,13H2,1H3,(H,14,15) |
| InChIKey | ULAJWPXFDJIQKY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.74 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|