C12H10Br2ClN3O — CID 62887202
[5-chloro-6-[(2,6-dibromophenoxy)methyl]-2-pyridinyl]hydrazine (PubChem CID 62887202) has the molecular formula C12H10Br2ClN3O and a molecular weight of 407.49 g/mol. Its IUPAC name is [5-chloro-6-[(2,6-dibromophenoxy)methyl]-2-pyridinyl]hydrazine.
| Compound Name | [5-chloro-6-[(2,6-dibromophenoxy)methyl]-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 62887202 |
| Molecular Formula | C12H10Br2ClN3O |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 404.89 |
| IUPAC Name | [5-chloro-6-[(2,6-dibromophenoxy)methyl]-2-pyridinyl]hydrazine |
| SMILES | NNc1ccc(Cl)c(COc2c(Br)cccc2Br)n1 |
| InChI | InChI=1S/C12H10Br2ClN3O/c13-7-2-1-3-8(14)12(7)19-6-10-9(15)4-5-11(17-10)18-16/h1-5H,6,16H2,(H,17,18) |
| InChIKey | WCUQMIBDUHMOKU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|