C14H21FN4 — CID 62887717
4-[2-[(dimethylamino)methyl]pyrrolidin-1-yl]-3-fluorobenzenecarboximidamide (PubChem CID 62887717) has the molecular formula C14H21FN4 and a molecular weight of 264.35 g/mol. Its IUPAC name is 4-[2-[(dimethylamino)methyl]pyrrolidin-1-yl]-3-fluorobenzenecarboximidamide.
| Compound Name | 4-[2-[(dimethylamino)methyl]pyrrolidin-1-yl]-3-fluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 62887717 |
| Molecular Formula | C14H21FN4 |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 4-[2-[(dimethylamino)methyl]pyrrolidin-1-yl]-3-fluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N2CCCC2CN(C)C)c(F)c1 |
| InChI | InChI=1S/C14H21FN4/c1-18(2)9-11-4-3-7-19(11)13-6-5-10(14(16)17)8-12(13)15/h5-6,8,11H,3-4,7,9H2,1-2H3,(H3,16,17) |
| InChIKey | FQTUBKYHYVWNFS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|