C14H26N4O2 — CID 62890091
1-(1,4-diazepan-1-yl)-2-[2-[(dimethylamino)methyl]pyrrolidin-1-yl]ethane-1,2-dione (PubChem CID 62890091) has the molecular formula C14H26N4O2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 1-(1,4-diazepan-1-yl)-2-[2-[(dimethylamino)methyl]pyrrolidin-1-yl]ethane-1,2-dione.
| Compound Name | 1-(1,4-diazepan-1-yl)-2-[2-[(dimethylamino)methyl]pyrrolidin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 62890091 |
| Molecular Formula | C14H26N4O2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 1-(1,4-diazepan-1-yl)-2-[2-[(dimethylamino)methyl]pyrrolidin-1-yl]ethane-1,2-dione |
| SMILES | CN(C)CC1CCCN1C(=O)C(=O)N1CCCNCC1 |
| InChI | InChI=1S/C14H26N4O2/c1-16(2)11-12-5-3-9-18(12)14(20)13(19)17-8-4-6-15-7-10-17/h12,15H,3-11H2,1-2H3 |
| InChIKey | ASPAZWCBPZLKJV-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|