C10H14F2N2O2S — CID 62890520
2-[1-tert-butyl-3-(difluoromethyl)pyrazol-5-yl]sulfanylacetic acid (PubChem CID 62890520) has the molecular formula C10H14F2N2O2S and a molecular weight of 264.30 g/mol. Its IUPAC name is 2-[1-tert-butyl-3-(difluoromethyl)pyrazol-5-yl]sulfanylacetic acid.
| Compound Name | 2-[1-tert-butyl-3-(difluoromethyl)pyrazol-5-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 62890520 |
| Molecular Formula | C10H14F2N2O2S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-[1-tert-butyl-3-(difluoromethyl)pyrazol-5-yl]sulfanylacetic acid |
| SMILES | CC(C)(C)n1nc(C(F)F)cc1SCC(=O)O |
| InChI | InChI=1S/C10H14F2N2O2S/c1-10(2,3)14-7(17-5-8(15)16)4-6(13-14)9(11)12/h4,9H,5H2,1-3H3,(H,15,16) |
| InChIKey | RKMVBAPYQUTDRJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |