C10H6F4N2 — CID 62890537
2-(difluoromethyl)-6,7-difluoroquinolin-4-amine (PubChem CID 62890537) has the molecular formula C10H6F4N2 and a molecular weight of 230.16 g/mol. Its IUPAC name is 2-(difluoromethyl)-6,7-difluoroquinolin-4-amine.
| Compound Name | 2-(difluoromethyl)-6,7-difluoroquinolin-4-amine |
|---|---|
| PubChem CID | 62890537 |
| Molecular Formula | C10H6F4N2 |
| Molecular Weight | 230.16 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 2-(difluoromethyl)-6,7-difluoroquinolin-4-amine |
| SMILES | Nc1cc(C(F)F)nc2cc(F)c(F)cc12 |
| InChI | InChI=1S/C10H6F4N2/c11-5-1-4-7(15)3-9(10(13)14)16-8(4)2-6(5)12/h1-3,10H,(H2,15,16) |
| InChIKey | UQWCFWAQRXTBHB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.16 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |