C9H10F2N2O3 — CID 62893011
4-(difluoromethyl)-2-(2-methoxyethyl)pyrimidine-5-carboxylic acid (PubChem CID 62893011) has the molecular formula C9H10F2N2O3 and a molecular weight of 232.19 g/mol. Its IUPAC name is 4-(difluoromethyl)-2-(2-methoxyethyl)pyrimidine-5-carboxylic acid.
| Compound Name | 4-(difluoromethyl)-2-(2-methoxyethyl)pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 62893011 |
| Molecular Formula | C9H10F2N2O3 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 4-(difluoromethyl)-2-(2-methoxyethyl)pyrimidine-5-carboxylic acid |
| SMILES | COCCc1ncc(C(=O)O)c(C(F)F)n1 |
| InChI | InChI=1S/C9H10F2N2O3/c1-16-3-2-6-12-4-5(9(14)15)7(13-6)8(10)11/h4,8H,2-3H2,1H3,(H,14,15) |
| InChIKey | CFOAEFIQTMQEEL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |