About 3-[[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]methyl]pyridine-2-carbonitrile
3-[[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]methyl]pyridine-2-carbonitrile (PubChem CID 62893857) has the molecular formula C11H11N5O
and a molecular weight of 229.24 g/mol. Its IUPAC name is 3-[[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]methyl]pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 3-[[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]methyl]pyridine-2-carbonitrile |
| PubChem CID | 62893857 |
| Molecular Formula | C11H11N5O |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 3-[[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]methyl]pyridine-2-carbonitrile |
| SMILES | Cc1noc(CNCc2cccnc2C#N)n1 |
| InChI | InChI=1S/C11H11N5O/c1-8-15-11(17-16-8)7-13-6-9-3-2-4-14-10(9)5-12/h2-4,13H,6-7H2,1H3 |
| InChIKey | SLHMHHFZYFEGEP-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]methyl]pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]methyl]pyridine-2-carbonitrile?
The IUPAC name of 3-[[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]methyl]pyridine-2-carbonitrile (CID 62893857) is 3-[[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]methyl]pyridine-2-carbonitrile.
What is the SMILES notation for 3-[[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]methyl]pyridine-2-carbonitrile?
The canonical SMILES for 3-[[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]methyl]pyridine-2-carbonitrile is Cc1noc(CNCc2cccnc2C#N)n1.
What is the InChIKey of 3-[[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]methyl]pyridine-2-carbonitrile?
The InChIKey is SLHMHHFZYFEGEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N5O/c1-8-15-11(17-16-8)7-13-6-9-3-2-4-14-10(9)5-12/h2-4,13H,6-7H2,1H3.
What are the key properties of 3-[[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]methyl]pyridine-2-carbonitrile?
3-[[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]methyl]pyridine-2-carbonitrile has a molecular weight of 229.24 g/mol, XLogP of 0.93, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]methyl]pyridine-2-carbonitrile is sourced from PubChem (CID 62893857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).