C14H20N4 — CID 62894272
3-[[3-(methylaminomethyl)piperidin-1-yl]methyl]pyridine-2-carbonitrile (PubChem CID 62894272) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is 3-[[3-(methylaminomethyl)piperidin-1-yl]methyl]pyridine-2-carbonitrile.
| Compound Name | 3-[[3-(methylaminomethyl)piperidin-1-yl]methyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 62894272 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 3-[[3-(methylaminomethyl)piperidin-1-yl]methyl]pyridine-2-carbonitrile |
| SMILES | CNCC1CCCN(Cc2cccnc2C#N)C1 |
| InChI | InChI=1S/C14H20N4/c1-16-9-12-4-3-7-18(10-12)11-13-5-2-6-17-14(13)8-15/h2,5-6,12,16H,3-4,7,9-11H2,1H3 |
| InChIKey | OXFQIIRPCRNCJO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |