C15H20N4 — CID 63169618
3-[(3-pyrrolidin-1-ylpyrrolidin-1-yl)methyl]pyridine-2-carbonitrile (PubChem CID 63169618) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-[(3-pyrrolidin-1-ylpyrrolidin-1-yl)methyl]pyridine-2-carbonitrile.
| Compound Name | 3-[(3-pyrrolidin-1-ylpyrrolidin-1-yl)methyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 63169618 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 3-[(3-pyrrolidin-1-ylpyrrolidin-1-yl)methyl]pyridine-2-carbonitrile |
| SMILES | N#Cc1ncccc1CN1CCC(N2CCCC2)C1 |
| InChI | InChI=1S/C15H20N4/c16-10-15-13(4-3-6-17-15)11-18-9-5-14(12-18)19-7-1-2-8-19/h3-4,6,14H,1-2,5,7-9,11-12H2 |
| InChIKey | LTRXJTMAHYBIPF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 43.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |