C15H18N6 — CID 107110060
3-[[4-(3-aminopyrazol-1-yl)piperidin-1-yl]methyl]pyridine-2-carbonitrile (PubChem CID 107110060) has the molecular formula C15H18N6 and a molecular weight of 282.35 g/mol. Its IUPAC name is 3-[[4-(3-aminopyrazol-1-yl)piperidin-1-yl]methyl]pyridine-2-carbonitrile.
| Compound Name | 3-[[4-(3-aminopyrazol-1-yl)piperidin-1-yl]methyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 107110060 |
| Molecular Formula | C15H18N6 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 3-[[4-(3-aminopyrazol-1-yl)piperidin-1-yl]methyl]pyridine-2-carbonitrile |
| SMILES | N#Cc1ncccc1CN1CCC(n2ccc(N)n2)CC1 |
| InChI | InChI=1S/C15H18N6/c16-10-14-12(2-1-6-18-14)11-20-7-3-13(4-8-20)21-9-5-15(17)19-21/h1-2,5-6,9,13H,3-4,7-8,11H2,(H2,17,19) |
| InChIKey | PEQIVKRRVCYUSK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 83.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |