C13H20N4O2 — CID 62897203
4-[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]-1,4-diazepan-2-one (PubChem CID 62897203) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 4-[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]-1,4-diazepan-2-one.
| Compound Name | 4-[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 62897203 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 4-[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]-1,4-diazepan-2-one |
| SMILES | Cc1nn(C)c(C)c1CC(=O)N1CCCNC(=O)C1 |
| InChI | InChI=1S/C13H20N4O2/c1-9-11(10(2)16(3)15-9)7-13(19)17-6-4-5-14-12(18)8-17/h4-8H2,1-3H3,(H,14,18) |
| InChIKey | UZWPYOFZFNTSTJ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |