C11H16N4O4S — CID 62898014
1-methyl-5-(3-oxo-1,4-diazepane-1-carbonyl)pyrrole-3-sulfonamide (PubChem CID 62898014) has the molecular formula C11H16N4O4S and a molecular weight of 300.34 g/mol. Its IUPAC name is 1-methyl-5-(3-oxo-1,4-diazepane-1-carbonyl)pyrrole-3-sulfonamide.
| Compound Name | 1-methyl-5-(3-oxo-1,4-diazepane-1-carbonyl)pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 62898014 |
| Molecular Formula | C11H16N4O4S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 1-methyl-5-(3-oxo-1,4-diazepane-1-carbonyl)pyrrole-3-sulfonamide |
| SMILES | Cn1cc(S(N)(=O)=O)cc1C(=O)N1CCCNC(=O)C1 |
| InChI | InChI=1S/C11H16N4O4S/c1-14-6-8(20(12,18)19)5-9(14)11(17)15-4-2-3-13-10(16)7-15/h5-6H,2-4,7H2,1H3,(H,13,16)(H2,12,18,19) |
| InChIKey | GJPWARGTDLKQRI-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |