C14H19NO4 — CID 62901200
2-(2-formyl-5-propoxyphenoxy)butanamide (PubChem CID 62901200) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 2-(2-formyl-5-propoxyphenoxy)butanamide.
| Compound Name | 2-(2-formyl-5-propoxyphenoxy)butanamide |
|---|---|
| PubChem CID | 62901200 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 2-(2-formyl-5-propoxyphenoxy)butanamide |
| SMILES | CCCOc1ccc(C=O)c(OC(CC)C(N)=O)c1 |
| InChI | InChI=1S/C14H19NO4/c1-3-7-18-11-6-5-10(9-16)13(8-11)19-12(4-2)14(15)17/h5-6,8-9,12H,3-4,7H2,1-2H3,(H2,15,17) |
| InChIKey | DZTCWVFYQAMBDN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|