C13H19BrN2 — CID 62908297
1-(3-bromo-4-pyrrolidin-1-ylphenyl)-N-methylethanamine (PubChem CID 62908297) has the molecular formula C13H19BrN2 and a molecular weight of 283.21 g/mol. Its IUPAC name is 1-(3-bromo-4-pyrrolidin-1-ylphenyl)-N-methylethanamine.
| Compound Name | 1-(3-bromo-4-pyrrolidin-1-ylphenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 62908297 |
| Molecular Formula | C13H19BrN2 |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 1-(3-bromo-4-pyrrolidin-1-ylphenyl)-N-methylethanamine |
| SMILES | CNC(C)c1ccc(N2CCCC2)c(Br)c1 |
| InChI | InChI=1S/C13H19BrN2/c1-10(15-2)11-5-6-13(12(14)9-11)16-7-3-4-8-16/h5-6,9-10,15H,3-4,7-8H2,1-2H3 |
| InChIKey | GVAOBXPWNXVUMA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|