C14H18BrNO2 — CID 62909487
1-[3-bromo-4-[2-(hydroxymethyl)piperidin-1-yl]phenyl]ethanone (PubChem CID 62909487) has the molecular formula C14H18BrNO2 and a molecular weight of 312.21 g/mol. Its IUPAC name is 1-[3-bromo-4-[2-(hydroxymethyl)piperidin-1-yl]phenyl]ethanone.
| Compound Name | 1-[3-bromo-4-[2-(hydroxymethyl)piperidin-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 62909487 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 1-[3-bromo-4-[2-(hydroxymethyl)piperidin-1-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCCCC2CO)c(Br)c1 |
| InChI | InChI=1S/C14H18BrNO2/c1-10(18)11-5-6-14(13(15)8-11)16-7-3-2-4-12(16)9-17/h5-6,8,12,17H,2-4,7,9H2,1H3 |
| InChIKey | UQAQXXDKHFEIIT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |