C12H19BrN2 — CID 62909492
4-(1-aminoethyl)-2-bromo-N,N-diethylaniline (PubChem CID 62909492) has the molecular formula C12H19BrN2 and a molecular weight of 271.20 g/mol. Its IUPAC name is 4-(1-aminoethyl)-2-bromo-N,N-diethylaniline.
| Compound Name | 4-(1-aminoethyl)-2-bromo-N,N-diethylaniline |
|---|---|
| PubChem CID | 62909492 |
| Molecular Formula | C12H19BrN2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 4-(1-aminoethyl)-2-bromo-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(C(C)N)cc1Br |
| InChI | InChI=1S/C12H19BrN2/c1-4-15(5-2)12-7-6-10(9(3)14)8-11(12)13/h6-9H,4-5,14H2,1-3H3 |
| InChIKey | FCRASMHQYYAVCL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |