C15H25BrN2 — CID 79477246
4-[(1S)-1-aminoethyl]-2-bromo-N-ethyl-N-(2-methylbutyl)aniline (PubChem CID 79477246) has the molecular formula C15H25BrN2 and a molecular weight of 313.28 g/mol. Its IUPAC name is 4-[(1S)-1-aminoethyl]-2-bromo-N-ethyl-N-(2-methylbutyl)aniline.
| Compound Name | 4-[(1S)-1-aminoethyl]-2-bromo-N-ethyl-N-(2-methylbutyl)aniline |
|---|---|
| PubChem CID | 79477246 |
| Molecular Formula | C15H25BrN2 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 4-[(1S)-1-aminoethyl]-2-bromo-N-ethyl-N-(2-methylbutyl)aniline |
| SMILES | CCC(C)CN(CC)c1ccc([C@H](C)N)cc1Br |
| InChI | InChI=1S/C15H25BrN2/c1-5-11(3)10-18(6-2)15-8-7-13(12(4)17)9-14(15)16/h7-9,11-12H,5-6,10,17H2,1-4H3/t11?,12-/m0/s1 |
| InChIKey | NDFFBOQHELRABB-KIYNQFGBSA-N |
| XLogP | 4.34 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |