C15H25BrN2O — CID 62912192
2-bromo-4-[1-(ethylamino)ethyl]-N-(1-methoxypropan-2-yl)-N-methylaniline (PubChem CID 62912192) has the molecular formula C15H25BrN2O and a molecular weight of 329.28 g/mol. Its IUPAC name is 2-bromo-4-[1-(ethylamino)ethyl]-N-(1-methoxypropan-2-yl)-N-methylaniline.
| Compound Name | 2-bromo-4-[1-(ethylamino)ethyl]-N-(1-methoxypropan-2-yl)-N-methylaniline |
|---|---|
| PubChem CID | 62912192 |
| Molecular Formula | C15H25BrN2O |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-bromo-4-[1-(ethylamino)ethyl]-N-(1-methoxypropan-2-yl)-N-methylaniline |
| SMILES | CCNC(C)c1ccc(N(C)C(C)COC)c(Br)c1 |
| InChI | InChI=1S/C15H25BrN2O/c1-6-17-12(3)13-7-8-15(14(16)9-13)18(4)11(2)10-19-5/h7-9,11-12,17H,6,10H2,1-5H3 |
| InChIKey | QTBMRANTPGTWED-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|