C15H20BrN3S — CID 62912215
2-bromo-4-[1-(ethylamino)ethyl]-N-methyl-N-(1,3-thiazol-4-ylmethyl)aniline (PubChem CID 62912215) has the molecular formula C15H20BrN3S and a molecular weight of 354.32 g/mol. Its IUPAC name is 2-bromo-4-[1-(ethylamino)ethyl]-N-methyl-N-(1,3-thiazol-4-ylmethyl)aniline.
| Compound Name | 2-bromo-4-[1-(ethylamino)ethyl]-N-methyl-N-(1,3-thiazol-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 62912215 |
| Molecular Formula | C15H20BrN3S |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 2-bromo-4-[1-(ethylamino)ethyl]-N-methyl-N-(1,3-thiazol-4-ylmethyl)aniline |
| SMILES | CCNC(C)c1ccc(N(C)Cc2cscn2)c(Br)c1 |
| InChI | InChI=1S/C15H20BrN3S/c1-4-17-11(2)12-5-6-15(14(16)7-12)19(3)8-13-9-20-10-18-13/h5-7,9-11,17H,4,8H2,1-3H3 |
| InChIKey | POUYDRUXHJKEHF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|