About 2-(3-bromo-4-fluorophenyl)-5,5-diethylmorpholine
2-(3-bromo-4-fluorophenyl)-5,5-diethylmorpholine (PubChem CID 62914274) has the molecular formula C14H19BrFNO
and a molecular weight of 316.21 g/mol. Its IUPAC name is 2-(3-bromo-4-fluorophenyl)-5,5-diethylmorpholine.
Molecular Properties
| Compound Name | 2-(3-bromo-4-fluorophenyl)-5,5-diethylmorpholine |
| PubChem CID | 62914274 |
| Molecular Formula | C14H19BrFNO |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 2-(3-bromo-4-fluorophenyl)-5,5-diethylmorpholine |
| SMILES | CCC1(CC)COC(c2ccc(F)c(Br)c2)CN1 |
| InChI | InChI=1S/C14H19BrFNO/c1-3-14(4-2)9-18-13(8-17-14)10-5-6-12(16)11(15)7-10/h5-7,13,17H,3-4,8-9H2,1-2H3 |
| InChIKey | OIBWRGNHSHKJAL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-bromo-4-fluorophenyl)-5,5-diethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromo-4-fluorophenyl)-5,5-diethylmorpholine?
The IUPAC name of 2-(3-bromo-4-fluorophenyl)-5,5-diethylmorpholine (CID 62914274) is 2-(3-bromo-4-fluorophenyl)-5,5-diethylmorpholine.
What is the SMILES notation for 2-(3-bromo-4-fluorophenyl)-5,5-diethylmorpholine?
The canonical SMILES for 2-(3-bromo-4-fluorophenyl)-5,5-diethylmorpholine is CCC1(CC)COC(c2ccc(F)c(Br)c2)CN1.
What is the InChIKey of 2-(3-bromo-4-fluorophenyl)-5,5-diethylmorpholine?
The InChIKey is OIBWRGNHSHKJAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19BrFNO/c1-3-14(4-2)9-18-13(8-17-14)10-5-6-12(16)11(15)7-10/h5-7,13,17H,3-4,8-9H2,1-2H3.
What are the key properties of 2-(3-bromo-4-fluorophenyl)-5,5-diethylmorpholine?
2-(3-bromo-4-fluorophenyl)-5,5-diethylmorpholine has a molecular weight of 316.21 g/mol, XLogP of 3.81, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromo-4-fluorophenyl)-5,5-diethylmorpholine is sourced from PubChem (CID 62914274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).