C14H19BrFNO — CID 62914274
2-(3-bromo-4-fluorophenyl)-5,5-diethylmorpholine (PubChem CID 62914274) has the molecular formula C14H19BrFNO and a molecular weight of 316.21 g/mol. Its IUPAC name is 2-(3-bromo-4-fluorophenyl)-5,5-diethylmorpholine.
| Compound Name | 2-(3-bromo-4-fluorophenyl)-5,5-diethylmorpholine |
|---|---|
| PubChem CID | 62914274 |
| Molecular Formula | C14H19BrFNO |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 2-(3-bromo-4-fluorophenyl)-5,5-diethylmorpholine |
| SMILES | CCC1(CC)COC(c2ccc(F)c(Br)c2)CN1 |
| InChI | InChI=1S/C14H19BrFNO/c1-3-14(4-2)9-18-13(8-17-14)10-5-6-12(16)11(15)7-10/h5-7,13,17H,3-4,8-9H2,1-2H3 |
| InChIKey | OIBWRGNHSHKJAL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |