C15H19F2NO — CID 62522508
3-(3,4-difluorophenyl)-4-oxa-1-azaspiro[5.5]undecane (PubChem CID 62522508) has the molecular formula C15H19F2NO and a molecular weight of 267.32 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-4-oxa-1-azaspiro[5.5]undecane.
| Compound Name | 3-(3,4-difluorophenyl)-4-oxa-1-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 62522508 |
| Molecular Formula | C15H19F2NO |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 3-(3,4-difluorophenyl)-4-oxa-1-azaspiro[5.5]undecane |
| SMILES | Fc1ccc(C2CNC3(CCCCC3)CO2)cc1F |
| InChI | InChI=1S/C15H19F2NO/c16-12-5-4-11(8-13(12)17)14-9-18-15(10-19-14)6-2-1-3-7-15/h4-5,8,14,18H,1-3,6-7,9-10H2 |
| InChIKey | MHKNDLFWSGLVSP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |