C18H25N — CID 62916002
N,4-dimethyl-3-(naphthalen-1-ylmethyl)pentan-2-amine (PubChem CID 62916002) has the molecular formula C18H25N and a molecular weight of 255.41 g/mol. Its IUPAC name is N,4-dimethyl-3-(naphthalen-1-ylmethyl)pentan-2-amine.
| Compound Name | N,4-dimethyl-3-(naphthalen-1-ylmethyl)pentan-2-amine |
|---|---|
| PubChem CID | 62916002 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | N,4-dimethyl-3-(naphthalen-1-ylmethyl)pentan-2-amine |
| SMILES | CNC(C)C(Cc1cccc2ccccc12)C(C)C |
| InChI | InChI=1S/C18H25N/c1-13(2)18(14(3)19-4)12-16-10-7-9-15-8-5-6-11-17(15)16/h5-11,13-14,18-19H,12H2,1-4H3 |
| InChIKey | WEUOTYHGLFOJQM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |