C14H18N2O3 — CID 62916480
N-[2-(3-hydroxypyrrolidin-1-yl)acetyl]-2-phenylacetamide (PubChem CID 62916480) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-[2-(3-hydroxypyrrolidin-1-yl)acetyl]-2-phenylacetamide.
| Compound Name | N-[2-(3-hydroxypyrrolidin-1-yl)acetyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 62916480 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-[2-(3-hydroxypyrrolidin-1-yl)acetyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NC(=O)CN1CCC(O)C1 |
| InChI | InChI=1S/C14H18N2O3/c17-12-6-7-16(9-12)10-14(19)15-13(18)8-11-4-2-1-3-5-11/h1-5,12,17H,6-10H2,(H,15,18,19) |
| InChIKey | HGKGXSDETXDCFC-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |