C12H19N3O4 — CID 79030579
2-[(3R)-3-hydroxypyrrolidin-1-yl]-N-[2-(2-oxopyrrolidin-1-yl)acetyl]acetamide (PubChem CID 79030579) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-[(3R)-3-hydroxypyrrolidin-1-yl]-N-[2-(2-oxopyrrolidin-1-yl)acetyl]acetamide.
| Compound Name | 2-[(3R)-3-hydroxypyrrolidin-1-yl]-N-[2-(2-oxopyrrolidin-1-yl)acetyl]acetamide |
|---|---|
| PubChem CID | 79030579 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-[(3R)-3-hydroxypyrrolidin-1-yl]-N-[2-(2-oxopyrrolidin-1-yl)acetyl]acetamide |
| SMILES | O=C(CN1CC[C@@H](O)C1)NC(=O)CN1CCCC1=O |
| InChI | InChI=1S/C12H19N3O4/c16-9-3-5-14(6-9)7-10(17)13-11(18)8-15-4-1-2-12(15)19/h9,16H,1-8H2,(H,13,17,18)/t9-/m1/s1 |
| InChIKey | AGFJAQZGIIBLAP-SECBINFHSA-N |
| XLogP | -1.68 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |