C10H20N2O3 — CID 144970843
N-acetyl-2-(2-oxopyrrolidin-1-yl)acetamide;ethane;molecular hydrogen (PubChem CID 144970843) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is N-acetyl-2-(2-oxopyrrolidin-1-yl)acetamide;ethane;molecular hydrogen.
| Compound Name | N-acetyl-2-(2-oxopyrrolidin-1-yl)acetamide;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 144970843 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | N-acetyl-2-(2-oxopyrrolidin-1-yl)acetamide;ethane;molecular hydrogen |
| SMILES | CC.CC(=O)NC(=O)CN1CCCC1=O.[H][H] |
| InChI | InChI=1S/C8H12N2O3.C2H6.H2/c1-6(11)9-7(12)5-10-4-2-3-8(10)13;1-2;/h2-5H2,1H3,(H,9,11,12);1-2H3;1H |
| InChIKey | YHDIWZPDEFZFEG-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |