C12H18N2O5S — CID 105353266
2-[2-oxo-2-[[2-(2-oxopyrrolidin-1-yl)acetyl]amino]ethyl]sulfanylbutanoic acid (PubChem CID 105353266) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is 2-[2-oxo-2-[[2-(2-oxopyrrolidin-1-yl)acetyl]amino]ethyl]sulfanylbutanoic acid.
| Compound Name | 2-[2-oxo-2-[[2-(2-oxopyrrolidin-1-yl)acetyl]amino]ethyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 105353266 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-[2-oxo-2-[[2-(2-oxopyrrolidin-1-yl)acetyl]amino]ethyl]sulfanylbutanoic acid |
| SMILES | CCC(SCC(=O)NC(=O)CN1CCCC1=O)C(=O)O |
| InChI | InChI=1S/C12H18N2O5S/c1-2-8(12(18)19)20-7-10(16)13-9(15)6-14-5-3-4-11(14)17/h8H,2-7H2,1H3,(H,18,19)(H,13,15,16) |
| InChIKey | VFPKLBCCRHUNMC-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |