C11H17N3O5S — CID 43440575
2-amino-3-[2-oxo-2-[[2-(2-oxopyrrolidin-1-yl)acetyl]amino]ethyl]sulfanylpropanoic acid (PubChem CID 43440575) has the molecular formula C11H17N3O5S and a molecular weight of 303.34 g/mol. Its IUPAC name is 2-amino-3-[2-oxo-2-[[2-(2-oxopyrrolidin-1-yl)acetyl]amino]ethyl]sulfanylpropanoic acid.
| Compound Name | 2-amino-3-[2-oxo-2-[[2-(2-oxopyrrolidin-1-yl)acetyl]amino]ethyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 43440575 |
| Molecular Formula | C11H17N3O5S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-amino-3-[2-oxo-2-[[2-(2-oxopyrrolidin-1-yl)acetyl]amino]ethyl]sulfanylpropanoic acid |
| SMILES | NC(CSCC(=O)NC(=O)CN1CCCC1=O)C(=O)O |
| InChI | InChI=1S/C11H17N3O5S/c12-7(11(18)19)5-20-6-9(16)13-8(15)4-14-3-1-2-10(14)17/h7H,1-6,12H2,(H,18,19)(H,13,15,16) |
| InChIKey | XVYVLZHBUJSSLT-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |