C12H14BrN3O3 — CID 62922079
2-[(2-amino-2-oxoethyl)-[2-(4-bromophenyl)-2-oxoethyl]amino]acetamide (PubChem CID 62922079) has the molecular formula C12H14BrN3O3 and a molecular weight of 328.17 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-[2-(4-bromophenyl)-2-oxoethyl]amino]acetamide.
| Compound Name | 2-[(2-amino-2-oxoethyl)-[2-(4-bromophenyl)-2-oxoethyl]amino]acetamide |
|---|---|
| PubChem CID | 62922079 |
| Molecular Formula | C12H14BrN3O3 |
| Molecular Weight | 328.17 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-[2-(4-bromophenyl)-2-oxoethyl]amino]acetamide |
| SMILES | NC(=O)CN(CC(N)=O)CC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H14BrN3O3/c13-9-3-1-8(2-4-9)10(17)5-16(6-11(14)18)7-12(15)19/h1-4H,5-7H2,(H2,14,18)(H2,15,19) |
| InChIKey | QPOKOGIMXIGVDT-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.17 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |