C11H20N4O5 — CID 62922822
(2S)-2-[bis(2-amino-2-oxoethyl)carbamoylamino]-3,3-dimethylbutanoic acid (PubChem CID 62922822) has the molecular formula C11H20N4O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is (2S)-2-[bis(2-amino-2-oxoethyl)carbamoylamino]-3,3-dimethylbutanoic acid.
| Compound Name | (2S)-2-[bis(2-amino-2-oxoethyl)carbamoylamino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 62922822 |
| Molecular Formula | C11H20N4O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (2S)-2-[bis(2-amino-2-oxoethyl)carbamoylamino]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)[C@H](NC(=O)N(CC(N)=O)CC(N)=O)C(=O)O |
| InChI | InChI=1S/C11H20N4O5/c1-11(2,3)8(9(18)19)14-10(20)15(4-6(12)16)5-7(13)17/h8H,4-5H2,1-3H3,(H2,12,16)(H2,13,17)(H,14,20)(H,18,19)/t8-/m1/s1 |
| InChIKey | FFDHRJNMPZMBSN-MRVPVSSYSA-N |
| XLogP | -1.53 |
| TPSA | 155.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |