C11H20N4O5 — CID 78918601
(2S)-2-[bis(2-amino-2-oxoethyl)carbamoylamino]-4-methylpentanoic acid (PubChem CID 78918601) has the molecular formula C11H20N4O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is (2S)-2-[bis(2-amino-2-oxoethyl)carbamoylamino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[bis(2-amino-2-oxoethyl)carbamoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 78918601 |
| Molecular Formula | C11H20N4O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (2S)-2-[bis(2-amino-2-oxoethyl)carbamoylamino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)N(CC(N)=O)CC(N)=O)C(=O)O |
| InChI | InChI=1S/C11H20N4O5/c1-6(2)3-7(10(18)19)14-11(20)15(4-8(12)16)5-9(13)17/h6-7H,3-5H2,1-2H3,(H2,12,16)(H2,13,17)(H,14,20)(H,18,19)/t7-/m0/s1 |
| InChIKey | IKIGTTCTYNIMSU-ZETCQYMHSA-N |
| XLogP | -1.53 |
| TPSA | 155.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |