C13H22N4S — CID 62926107
4-[1-(diethylamino)propan-2-ylamino]pyridine-2-carbothioamide (PubChem CID 62926107) has the molecular formula C13H22N4S and a molecular weight of 266.41 g/mol. Its IUPAC name is 4-[1-(diethylamino)propan-2-ylamino]pyridine-2-carbothioamide.
| Compound Name | 4-[1-(diethylamino)propan-2-ylamino]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 62926107 |
| Molecular Formula | C13H22N4S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 4-[1-(diethylamino)propan-2-ylamino]pyridine-2-carbothioamide |
| SMILES | CCN(CC)CC(C)Nc1ccnc(C(N)=S)c1 |
| InChI | InChI=1S/C13H22N4S/c1-4-17(5-2)9-10(3)16-11-6-7-15-12(8-11)13(14)18/h6-8,10H,4-5,9H2,1-3H3,(H2,14,18)(H,15,16) |
| InChIKey | LTZNUVAIKGEGSM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|